Systematic / IUPAC Name: 2-[3-Nitro-4-(2-pyridinylsulfanyl)phenyl]quinoxaline
ID: Reference4257
Other Names: Quinoxaline, 2-[3-nitro-4-(2-pyridinylthio)phenyl]-
Formula: C19H12N4O2S
2-[3-Nitro-4-(2-pyridylthio)phenyl]quinoxaline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 9:00:06 AM |
| InChI | InChI=1S/C19H12N4O2S/c24-23(25)17-11-13(8-9-18(17)26-19-7-3-4-10-20-19)16-12-21-14-5-1-2-6-15(14)22-16/h1-12H |
| InChI Key | SEKDEJAQNVOXMU-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Quinoxaline, 2-[3-nitro-4-(2-pyridinylthio)phenyl]- |