Systematic / IUPAC Name: N-(9,10-Dioxo-9,10-dihydro-2-anthracenyl)benzamide
ID: Reference4263
Other Names:
Anthraquinone, 2-benzamido-;
N-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)benzamide;
Benzamide, N-(9,10-dihydro-9,10-dioxo-2-anthracenyl)-
Formula: C21H13NO3
N1-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 235 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 11:39:52 AM |
| InChI | InChI=1S/C21H13NO3/c23-19-15-8-4-5-9-16(15)20(24)18-12-14(10-11-17(18)19)22-21(25)13-6-2-1-3-7-13/h1-12H,(H,22,25) |
| InChI Key | SIGATAYQAZTAOH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)C(=O)C4=CC=CC=C4C3=O |
| CAS | 52869188 |
| Splash | |
| Other Names |
Anthraquinone, 2-benzamido-; N-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)benzamide; Benzamide, N-(9,10-dihydro-9,10-dioxo-2-anthracenyl)- |