Systematic / IUPAC Name: N-[4-Methoxy-5-(4-morpholinyl)-2-nitrophenyl]-2-pyridinamine
ID: Reference4264
Other Names: 2-Pyridinamine, N-[4-methoxy-5-(4-morpholinyl)-2-nitrophenyl]-
Formula: C16H18N4O4
N-(4-Methoxy-5-morpholino-2-nitrophenyl)-N-(2-pyridyl)amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 211 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2016 11:41:24 AM |
| InChI | InChI=1S/C16H18N4O4/c1-23-15-11-13(20(21)22)12(18-16-4-2-3-5-17-16)10-14(15)19-6-8-24-9-7-19/h2-5,10-11H,6-9H2,1H3,(H,17,18) |
| InChI Key | YJAPDJWGXUSQPF-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Pyridinamine, N-[4-methoxy-5-(4-morpholinyl)-2-nitrophenyl]- |