Systematic / IUPAC Name: 4-[3,5-Bis(trifluoromethyl)phenyl]-5-[2-(4-hydroxyphenyl)ethyl]-2,4-dihydro-3H-1,2,4-triazole-3-thione
ID: Reference4273
Other Names: 4-(2-{4-[3,5-Bis(trifluoromethyl)phenyl]-5-mercapto-4H-1,2,4-triazol-3-yl}ethyl)phenol
Formula: C18H13F6N3OS
4-(2-{4-[3,5-Bis(trifluoromethyl)phenyl]-5-mercapto-4H-1,2,4-triazol-3-yl}ethyl)phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 7:05:53 AM |
| InChI | InChI=1S/C18H13F6N3OS/c19-17(20,21)11-7-12(18(22,23)24)9-13(8-11)27-15(25-26-16(27)29)6-3-10-1-4-14(28)5-2-10/h1-2,4-5,7-9,28H,3,6H2,(H,26,29) |
| InChI Key | QEXDNHQSIWTMNH-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1CCC2=NNC(=S)N2C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | 4-(2-{4-[3,5-Bis(trifluoromethyl)phenyl]-5-mercapto-4H-1,2,4-triazol-3-yl}ethyl)phenol |