Systematic / IUPAC Name: N-[4-Fluoro-5-(4-morpholinyl)-2-nitrophenyl]acetamide
ID: Reference4275
Other Names: Acetamide, N-[4-fluoro-5-(4-morpholinyl)-2-nitrophenyl]-
Formula: C12H14FN3O4
N1-(4-Fluoro-5-morpholino-2-nitrophenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 7:09:45 AM |
| InChI | InChI=1S/C12H14FN3O4/c1-8(17)14-10-7-11(15-2-4-20-5-3-15)9(13)6-12(10)16(18)19/h6-7H,2-5H2,1H3,(H,14,17) |
| InChI Key | SAVUYXNZIAAXGX-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-[4-fluoro-5-(4-morpholinyl)-2-nitrophenyl]- |