Systematic / IUPAC Name: 4-(Hydroxymethyl)-2-methyl-5-({[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl}methyl)-3-pyridinol
ID: Reference4279
Other Names: 4-Pyridinemethanol, 3-hydroxy-2-methyl-5-({[6-(trifluoromethyl)-1H-benzimidazol-2-yl]thio}methyl)-
Formula: C16H14F3N3O2S
4-(Hydroxymethyl)-2-methyl-5-({[5-(trifluoromethyl)-1H-benzo[d]imidazol-2-yl]thio}methyl)pyridin-3-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 9:22:10 AM |
| InChI | InChI=1S/C16H14F3N3O2S/c1-8-14(24)11(6-23)9(5-20-8)7-25-15-21-12-3-2-10(16(17,18)19)4-13(12)22-15/h2-5,23-24H,6-7H2,1H3,(H,21,22) |
| InChI Key | WLUKKTLBTKOTSG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NC=C(C(=C1O)CO)CSC2=NC3=C(N2)C=C(C=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 4-Pyridinemethanol, 3-hydroxy-2-methyl-5-({[6-(trifluoromethyl)-1H-benzimidazol-2-yl]thio}methyl)- |