Systematic / IUPAC Name: 2,4-Bis(3,5-dichlorophenyl)-1,2,4-thiadiazolidine-3,5-diimine
ID: Reference4281
Other Names:
Formula: C14H8Cl4N4S
2,4-Bis(3,5-dichlorophenyl)-3,5-diimino-1,2,4-thiadiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 9:28:56 AM |
| InChI | InChI=1S/C14H8Cl4N4S/c15-7-1-8(16)4-11(3-7)21-13(19)22(23-14(21)20)12-5-9(17)2-10(18)6-12/h1-6,19-20H |
| InChI Key | BLEFMKYWHUOETH-UHFFFAOYSA-N |
| Canonical SMILES | C1=C(C=C(C=C1Cl)Cl)N2C(=N)N(SC2=N)C3=CC(=CC(=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |