Systematic / IUPAC Name: ({(E)-[2-(Trifluoromethoxy)benzylidene]amino}oxy)(3,4,5-trimethoxyphenyl)methanone
ID: Reference4288
Other Names: Benzaldehyde, 2-(trifluoromethoxy), O-(3,4,5-trimethoxybenzoyl)oxime
Formula: C18H16F3NO6
1,2,3-Trimethoxy-5-{[({[2-(trifluoromethoxy)phenyl]methylene}amino)oxy]carbonyl}benzene mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 11:40:42 AM |
| InChI | InChI=1S/C18H16F3NO6/c1-24-14-8-12(9-15(25-2)16(14)26-3)17(23)28-22-10-11-6-4-5-7-13(11)27-18(19,20)21/h4-10H,1-3H3/b22-10+ |
| InChI Key | JHONBVHFQGSPBN-LSHDLFTRSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)ON=CC2=CC=CC=C2OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Benzaldehyde, 2-(trifluoromethoxy), O-(3,4,5-trimethoxybenzoyl)oxime |