Systematic / IUPAC Name: Ethyl 5-ethyl-2-({[2-(trifluoromethyl)phenyl]carbamothioyl}amino)-3-thiophenecarboxylate
ID: Reference4289
Other Names: 3-Thiophenecarboxylic acid, 5-ethyl-2-[(thioxo{[2-(trifluoromethyl)phenyl]amino}methyl)amino]-, ethyl ester
Formula: C17H17F3N2O2S2
Ethyl 5-ethyl-2-({[2-(trifluoromethyl)anilino]carbothioyl}amino)thiophene-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 351 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 12:32:29 PM |
| InChI | InChI=1S/C17H17F3N2O2S2/c1-3-10-9-11(15(23)24-4-2)14(26-10)22-16(25)21-13-8-6-5-7-12(13)17(18,19)20/h5-9H,3-4H2,1-2H3,(H2,21,22,25) |
| InChI Key | POVWPEVKWJGBLU-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC(=C(S1)NC(=S)NC2=CC=CC=C2C(F)(F)F)C(=O)OCC |
| CAS | |
| Splash | |
| Other Names | 3-Thiophenecarboxylic acid, 5-ethyl-2-[(thioxo{[2-(trifluoromethyl)phenyl]amino}methyl)amino]-, ethyl ester |