Systematic / IUPAC Name: N-{5-[(Cyanomethyl)sulfanyl]-1,3,4-thiadiazol-2-yl}acetamide
ID: Reference4295
Other Names: Acetamide, N-{5-[(cyanomethyl)thio]-1,3,4-thiadiazol-2-yl}-
Formula: C6H6N4OS2
N1-{5-[(Cyanomethyl)thio]-1,3,4-thiadiazol-2-yl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 2:01:16 PM |
| InChI | InChI=1S/C6H6N4OS2/c1-4(11)8-5-9-10-6(13-5)12-3-2-7/h3H2,1H3,(H,8,9,11) |
| InChI Key | OSGVBEVJCNQOAU-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=NN=C(S1)SCC#N |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-{5-[(cyanomethyl)thio]-1,3,4-thiadiazol-2-yl}- |