Systematic / IUPAC Name: 7-Phenyl-6-(trifluoromethyl)-4-{[3-(trifluoromethyl)phenyl]sulfanyl}thieno[3,2-d]pyrimidine
ID: Reference4297
Other Names: Thieno[3,2-d]pyrimidine, 7-phenyl-6-(trifluoromethyl)-4-{[3-(trifluoromethyl)phenyl]thio}-
Formula: C20H10F6N2S2
7-Phenyl-6-(trifluoromethyl)-4-{[3-(trifluoromethyl)phenyl]thio}thieno[3,2-d]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/18/2016 2:12:36 PM |
| InChI | InChI=1S/C20H10F6N2S2/c21-19(22,23)12-7-4-8-13(9-12)29-18-16-15(27-10-28-18)14(11-5-2-1-3-6-11)17(30-16)20(24,25)26/h1-10H |
| InChI Key | MYKRJGHZAZSDIT-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(SC3=C2N=CN=C3SC4=CC=CC(=C4)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Thieno[3,2-d]pyrimidine, 7-phenyl-6-(trifluoromethyl)-4-{[3-(trifluoromethyl)phenyl]thio}- |