Systematic / IUPAC Name: 7-Nitro-N-(2-phenylethyl)-1H-indole-2-carboxamide
ID: Reference4298
Other Names: 1H-Indole-2-carboxamide, 7-nitro-N-(2-phenylethyl)-
Formula: C17H15N3O3
7-Nitro-N-phenethyl-1H-indole-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 7:01:07 AM |
| InChI | InChI=1S/C17H15N3O3/c21-17(18-10-9-12-5-2-1-3-6-12)14-11-13-7-4-8-15(20(22)23)16(13)19-14/h1-8,11,19H,9-10H2,(H,18,21) |
| InChI Key | VXDJRTJBOJFUOC-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 1H-Indole-2-carboxamide, 7-nitro-N-(2-phenylethyl)- |