Systematic / IUPAC Name: 2-{4-[2-(Trifluoromethyl)-4-quinolinyl]-1-piperazinyl}ethanol
ID: Reference4300
Other Names: 1-Piperazineethanol, 4-[2-(trifluoromethyl)-4-quinolinyl]-
Formula: C16H18F3N3O
2-{4-[2-(Trifluoromethyl)quinolin-4-yl]piperazino}ethan-1-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 7:10:49 AM |
| InChI | InChI=1S/C16H18F3N3O/c17-16(18,19)15-11-14(12-3-1-2-4-13(12)20-15)22-7-5-21(6-8-22)9-10-23/h1-4,11,23H,5-10H2 |
| InChI Key | FEZXFBBKVKXGCH-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1CCO)C2=CC(=NC3=CC=CC=C32)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 1-Piperazineethanol, 4-[2-(trifluoromethyl)-4-quinolinyl]- |
| ChEMBL | CHEMBL1538577 |
| ChemSpider | 2101706 |
| PubChem | 2823494 |