Systematic / IUPAC Name: 1-{6-[(4-Methylphenyl)sulfanyl]-3-pyridinyl}-3-[4-(trifluoromethoxy)phenyl]urea
ID: Reference4304
Other Names:
N-{6-[(4-Methylphenyl)thio]-3-pyridyl}-N'-[4-(trifluoromethoxy)phenyl]urea ;
Urea, N-{6-[(4-methylphenyl)thio]-3-pyridinyl}-N'-[4-(trifluoromethoxy)phenyl]-
Formula: C20H16F3N3O2S
N-{6-[(4-Methylphenyl)thio]-3-pyridyl}-N'-[4-(trifluoromethoxy)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 9:54:20 AM |
| InChI | InChI=1S/C20H16F3N3O2S/c1-13-2-9-17(10-3-13)29-18-11-6-15(12-24-18)26-19(27)25-14-4-7-16(8-5-14)28-20(21,22)23/h2-12H,1H3,(H2,25,26,27) |
| InChI Key | OOOKYCQMTWMZQY-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)SC2=NC=C(C=C2)NC(=O)NC3=CC=C(C=C3)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
N-{6-[(4-Methylphenyl)thio]-3-pyridyl}-N'-[4-(trifluoromethoxy)phenyl]urea ; Urea, N-{6-[(4-methylphenyl)thio]-3-pyridinyl}-N'-[4-(trifluoromethoxy)phenyl]- |