Systematic / IUPAC Name: 2-(2-Thienyl)-N-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)phenyl]acetamide
ID: Reference4308
Other Names: 2-Thiopheneacetamide, N-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)phenyl]-
Formula: C15H11F6NO2S
N1-[2-(2,2,2-Trifluoroethoxy)-5-(trifluoromethyl)phenyl]-2-(2-thienyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 9:19:49 AM |
| InChI | InChI=1S/C15H11F6NO2S/c16-14(17,18)8-24-12-4-3-9(15(19,20)21)6-11(12)22-13(23)7-10-2-1-5-25-10/h1-6H,7-8H2,(H,22,23) |
| InChI Key | TYONYSVUAPIUAM-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)CC(=O)NC2=C(C=CC(=C2)C(F)(F)F)OCC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 2-Thiopheneacetamide, N-[2-(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)phenyl]- |