Systematic / IUPAC Name: 4-(4-Ethoxyphenyl)-4-oxobutanoic acid
ID: Reference4314
Other Names:
3-(4-Ethoxybenzoyl)propanoic acid;
3-(4-Ethoxybenzoyl)propionic acid;
4-(4-Ethoxyphenyl)-4-oxobutyric acid;
Benzenebutanoic acid, 4-ethoxy-γ-oxo-
Formula: C12H14O4
4-(4-Ethoxyphenyl)-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 12:09:39 PM |
| InChI | InChI=1S/C12H14O4/c1-2-16-10-5-3-9(4-6-10)11(13)7-8-12(14)15/h3-6H,2,7-8H2,1H3,(H,14,15) |
| InChI Key | HXMFVOXVXQBEEJ-UHFFFAOYSA-N |
| Canonical SMILES | CCOC1=CC=C(C=C1)C(=O)CCC(=O)O |
| CAS | 53623373 |
| Splash | |
| Other Names |
3-(4-Ethoxybenzoyl)propanoic acid; 3-(4-Ethoxybenzoyl)propionic acid; 4-(4-Ethoxyphenyl)-4-oxobutyric acid; Benzenebutanoic acid, 4-ethoxy-γ-oxo- |
| ChemSpider | 633651 |
| ChEMBL | CHEMBL1742087 |
| PubChem | 725709 |