Systematic / IUPAC Name: 1-Allyl-3-{4-[3,5-bis(trifluoromethyl)phenoxy]phenyl}thiourea
ID: Reference4318
Other Names: Thiourea, N-{4-[3,5-bis(trifluoromethyl)phenoxy]phenyl}-N'-2-propen-1-yl-
Formula: C18H14F6N2OS
N-Allyl-N'-{4-[3,5-bis(trifluoromethyl)phenoxy]phenyl}thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 1:12:53 PM |
| InChI | InChI=1S/C18H14F6N2OS/c1-2-7-25-16(28)26-13-3-5-14(6-4-13)27-15-9-11(17(19,20)21)8-12(10-15)18(22,23)24/h2-6,8-10H,1,7H2,(H2,25,26,28) |
| InChI Key | FMBGFTVRZRFLPJ-UHFFFAOYSA-N |
| Canonical SMILES | C=CCNC(=S)NC1=CC=C(C=C1)OC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-{4-[3,5-bis(trifluoromethyl)phenoxy]phenyl}-N'-2-propen-1-yl- |