Systematic / IUPAC Name: (E)-N-Benzyl-2-[1-(4-bromophenyl)-1H-tetrazol-5-yl]ethenamine
ID: Reference4319
Other Names: Benzenemethanamine, N-{(E)-2-[1-(4-bromophenyl)-1H-tetrazol-5-yl]ethenyl}-
Formula: C16H14BrN5
N1-Benzyl-2-[1-(4-bromophenyl)-1H-1,2,3,4-tetraazol-5-yl]eth-1-en-1-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 1:41:43 PM |
| InChI | InChI=1S/C16H14BrN5/c17-14-6-8-15(9-7-14)22-16(19-20-21-22)10-11-18-12-13-4-2-1-3-5-13/h1-11,18H,12H2/b11-10+ |
| InChI Key | PBVHEJMNFVRXHX-ZHACJKMWSA-N |
| Canonical SMILES | C1=CC=C(C=C1)CNC=CC2=NN=NN2C3=CC=C(C=C3)Br |
| CAS | |
| Splash | |
| Other Names | Benzenemethanamine, N-{(E)-2-[1-(4-bromophenyl)-1H-tetrazol-5-yl]ethenyl}- |