Systematic / IUPAC Name: 2-[(2E)-2-(3,5-Dichlorobenzylidene)hydrazino]-5-nitropyridine
ID: Reference4322
Other Names: Benzaldehyde, 3,5-dichloro-, 2-(5-nitro-2-pyridinyl)hydrazone
Formula: C12H8Cl2N4O2
3,5-Dichlorobenzaldehyde N-(5-nitropyridin-2-yl)hydrazone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 2:36:51 PM |
| InChI | InChI=1S/C12H8Cl2N4O2/c13-9-3-8(4-10(14)5-9)6-16-17-12-2-1-11(7-15-12)18(19)20/h1-7H,(H,15,17)/b16-6+ |
| InChI Key | QAXDKXHPEDBRBB-OMCISZLKSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzaldehyde, 3,5-dichloro-, 2-(5-nitro-2-pyridinyl)hydrazone |