Systematic / IUPAC Name: N-(6-{4-[5-(Trifluoromethyl)-2-pyridinyl]-1-piperazinyl}-3-pyridinyl)methanesulfonamide
ID: Reference4324
Other Names: Methanesulfonamide, N-{6-[4-[5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-3-pyridinyl}-
Formula: C16H18F3N5O2S
N-(6-{4-[5-(Trifluoromethyl)pyridin-2-yl]piperazino}pyridin-3-yl)methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/21/2016 3:00:54 PM |
| InChI | InChI=1S/C16H18F3N5O2S/c1-27(25,26)22-13-3-5-15(21-11-13)24-8-6-23(7-9-24)14-4-2-12(10-20-14)16(17,18)19/h2-5,10-11,22H,6-9H2,1H3 |
| InChI Key | DSAWRRROKBCABA-UHFFFAOYSA-N |
| Canonical SMILES | CS(=O)(=O)NC1=CN=C(C=C1)N2CCN(CC2)C3=NC=C(C=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Methanesulfonamide, N-{6-[4-[5-(trifluoromethyl)-2-pyridinyl]-1-piperazinyl]-3-pyridinyl}- |
| ChEMBL | CHEMBL1423276 |
| ChemSpider | 2023331 |
| PubChem | 2741775 |