Systematic / IUPAC Name: Ethyl 2-({[4-(isopropylsulfonyl)-5-(methylsulfanyl)-2-thienyl]carbonyl}amino)-4,5-dimethyl-3-thiophenecarboxylate
ID: Reference4325
Other Names: 3-Thiophenecarboxylic acid, 4,5-dimethyl-2-[({4-[(1-methylethyl)sulfonyl]-5-(methylthio)-2-thienyl}carbonyl)amino]-, ethyl ester
Formula: C18H23NO5S4
Ethyl 2-({[4-(isopropylsulfonyl)-5-(methylthio)-2-thienyl]carbonyl}amino)-4,5-dimethylthiophene-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 252 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 6:36:18 AM |
| InChI | InChI=1S/C18H23NO5S4/c1-7-24-17(21)14-10(4)11(5)26-16(14)19-15(20)12-8-13(18(25-6)27-12)28(22,23)9(2)3/h8-9H,7H2,1-6H3,(H,19,20) |
| InChI Key | IBQMALNJMURWSV-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(SC(=C1C)C)NC(=O)C2=CC(=C(S2)SC)S(=O)(=O)C(C)C |
| CAS | |
| Splash | |
| Other Names | 3-Thiophenecarboxylic acid, 4,5-dimethyl-2-[({4-[(1-methylethyl)sulfonyl]-5-(methylthio)-2-thienyl}carbonyl)amino]-, ethyl ester |