Systematic / IUPAC Name: 2-(Methylsulfanyl)-5-[(2-thienylmethyl)sulfonyl]-4-pyrimidinamine
ID: Reference4335
Other Names: Pyrimidin-4-amine, 2-methylthio-5-(2-thienylmethylsulfonyl)-
Formula: C10H11N3O2S3
2-(Methylthio)-5-[(2-thienylmethyl)sulfonyl]pyrimidin-4-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 12:41:54 PM |
| InChI | InChI=1S/C10H11N3O2S3/c1-16-10-12-5-8(9(11)13-10)18(14,15)6-7-3-2-4-17-7/h2-5H,6H2,1H3,(H2,11,12,13) |
| InChI Key | LVUBKTOMUOOHJC-UHFFFAOYSA-N |
| Canonical SMILES | CSC1=NC=C(C(=N1)N)S(=O)(=O)CC2=CC=CS2 |
| CAS | |
| Splash | |
| Other Names | Pyrimidin-4-amine, 2-methylthio-5-(2-thienylmethylsulfonyl)- |