Systematic / IUPAC Name: 2-Methyl-6-[(2-methyl-2-propanyl)sulfonyl]pyrazolo[1,5-a]pyrimidin-7-amine
ID: Reference4342
Other Names: 6-(tert-Butylsulfonyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine
Formula: C11H16N4O2S
6-(tert-Butylsulfonyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/22/2016 3:27:59 PM |
| InChI | InChI=1S/C11H16N4O2S/c1-7-5-9-13-6-8(10(12)15(9)14-7)18(16,17)11(2,3)4/h5-6H,12H2,1-4H3 |
| InChI Key | ODVSVKPPVBSCJX-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN2C(=C1)N=CC(=C2N)S(=O)(=O)C(C)(C)C |
| CAS | 519056496 |
| Splash | |
| Other Names | 6-(tert-Butylsulfonyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| ChemSpider | 2097746 |
| ChEMBL | CHEMBL1337972 |
| PubChem | 2819516 |