Systematic / IUPAC Name: Methyl 1,2,3,4-tetrahydro-2-quinolinecarboxylate
ID: Reference4354
Other Names:
1,2,3,4-Tetrahydro-2-quinolinecarboxylic acid methyl ester;
1,2,3,4-Tetrahydroquinoline-2-carboxylic acid methyl ester
Formula: C11H13NO2
Methyl 1,2,3,4-tetrahydroquinoline-2-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2016 6:48:03 AM |
| InChI | InChI=1S/C11H13NO2/c1-14-11(13)10-7-6-8-4-2-3-5-9(8)12-10/h2-5,10,12H,6-7H2,1H3 |
| InChI Key | ACEPYLDNGYGKDY-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1CCC2=CC=CC=C2N1 |
| CAS | |
| Splash | |
| Other Names |
1,2,3,4-Tetrahydro-2-quinolinecarboxylic acid methyl ester; 1,2,3,4-Tetrahydroquinoline-2-carboxylic acid methyl ester |