Systematic / IUPAC Name: N-(1H-1,2,4-Triazol-5-ylcarbamothioyl)benzamide
ID: Reference4359
Other Names:
N-Benzoyl-N'-(1H-1,2,4-triazol-3-yl)thiourea ;
Benzamide, N-[thioxo(1H-1,2,4-triazol-5-ylamino)methyl]-
Formula: C10H9N5OS
N-Benzoyl-N'-(1H-1,2,4-triazol-3-yl)thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2016 10:14:45 AM |
| InChI | InChI=1S/C10H9N5OS/c16-8(7-4-2-1-3-5-7)13-10(17)14-9-11-6-12-15-9/h1-6H,(H3,11,12,13,14,15,16,17) |
| InChI Key | ISJKWWWRJNONKI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=NC=NN2 |
| CAS | |
| Splash | |
| Other Names |
N-Benzoyl-N'-(1H-1,2,4-triazol-3-yl)thiourea ; Benzamide, N-[thioxo(1H-1,2,4-triazol-5-ylamino)methyl]- |
| PubChem | 2806529 |
| ChemSpider | 2085030 |
| ChEMBL | CHEMBL2063616 |