Systematic / IUPAC Name: N-(1,1-Dioxidotetrahydro-3-thiophenyl)-N-methyl-2-(4-phenoxyphenoxy)acetamide
ID: Reference4361
Other Names:
N-(1,1-Dioxidotetrahydrothiophen-3-yl)-N-methyl-2-(4-phenoxyphenoxy)acetamide;
Acetamide, N-methyl-2-(4-phenoxyphenoxy)-N-(tetrahydro-1,1-dioxido-3-thienyl)-
Formula: C19H21NO5S
N-(1,1-Dioxotetrahydro-1H-1λ6-thiophen-3-yl)-N-methyl-2-(4-phenoxyphenoxy)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2016 12:04:15 PM |
| InChI | InChI=1S/C19H21NO5S/c1-20(15-11-12-26(22,23)14-15)19(21)13-24-16-7-9-18(10-8-16)25-17-5-3-2-4-6-17/h2-10,15H,11-14H2,1H3 |
| InChI Key | KEDSCUQZRCJHQO-UHFFFAOYSA-N |
| Canonical SMILES | CN(C1CCS(=O)(=O)C1)C(=O)COC2=CC=C(C=C2)OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names |
N-(1,1-Dioxidotetrahydrothiophen-3-yl)-N-methyl-2-(4-phenoxyphenoxy)acetamide; Acetamide, N-methyl-2-(4-phenoxyphenoxy)-N-(tetrahydro-1,1-dioxido-3-thienyl)- |
| ChemSpider | 549647 |
| PubChem | 633100 |
| ChEMBL | CHEMBL1405673 |