Systematic / IUPAC Name: 4-Bromo-2-{[(4-fluorophenyl)amino]methyl}phenol
ID: Reference4367
Other Names: 4-Bromo-2-[(4-fluoroanilino)methyl]benzenol
Formula: C13H11BrFNO
4-Bromo-2-[(4-fluoroanilino)methyl]phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2016 7:45:27 AM |
| InChI | InChI=1S/C13H11BrFNO/c14-10-1-6-13(17)9(7-10)8-16-12-4-2-11(15)3-5-12/h1-7,16-17H,8H2 |
| InChI Key | URTHHJMPBVKWJU-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1NCC2=C(C=CC(=C2)Br)O)F |
| CAS | |
| Splash | |
| Other Names | 4-Bromo-2-[(4-fluoroanilino)methyl]benzenol |