Systematic / IUPAC Name: 1-{4-[(Z)-1-Cyano-2-(3,4-dichlorophenyl)vinyl]phenyl}urea
ID: Reference4369
Other Names: Urea, N-{4-[(Z)-1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl}-
Formula: C16H11Cl2N3O
N-{4-[1-Cyano-2-(3,4-dichlorophenyl)vinyl]phenyl}urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 65 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2016 1:00:52 PM |
| InChI | InChI=1S/C16H11Cl2N3O/c17-14-6-1-10(8-15(14)18)7-12(9-19)11-2-4-13(5-3-11)21-16(20)22/h1-8H,(H3,20,21,22)/b12-7+ |
| InChI Key | CXKLKKJQZBAPFT-KPKJPENVSA-N |
| Canonical SMILES | C1=CC(=CC=C1C(=CC2=CC(=C(C=C2)Cl)Cl)C#N)NC(=O)N |
| CAS | |
| Splash | |
| Other Names | Urea, N-{4-[(Z)-1-cyano-2-(3,4-dichlorophenyl)ethenyl]phenyl}- |