Systematic / IUPAC Name: N-(2-Cyanoethyl)-N-cyclohexyl-3-nitro-4-(phenylsulfanyl)benzamide
ID: Reference4370
Other Names: Benzamide, N-(2-cyanoethyl)-N-cyclohexyl-3-nitro-4-(phenylthio)-
Formula: C22H23N3O3S
N1-(2-Cyanoethyl)-N1-cyclohexyl-3-nitro-4-(phenylthio)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 130 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/29/2016 12:52:34 PM |
| InChI | InChI=1S/C22H23N3O3S/c23-14-7-15-24(18-8-3-1-4-9-18)22(26)17-12-13-21(20(16-17)25(27)28)29-19-10-5-2-6-11-19/h2,5-6,10-13,16,18H,1,3-4,7-9,15H2 |
| InChI Key | ZFLFOIDQIYQYAO-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Benzamide, N-(2-cyanoethyl)-N-cyclohexyl-3-nitro-4-(phenylthio)- |