Systematic / IUPAC Name: 2-(Cyanoacetyl)-N-(3,4-dichlorophenyl)hydrazinecarbothioamide
ID: Reference4372
Other Names: Acetic acid, 2-cyano-, 2-{[(3,4-dichlorophenyl)amino]thioxomethyl}hydrazide
Formula: C10H8Cl2N4OS
2-(2-Cyanoacetyl)-N-(3,4-dichlorophenyl)hydrazine-1-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 210 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 6:47:20 AM |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-7-2-1-6(5-8(7)12)14-10(18)16-15-9(17)3-4-13/h1-2,5H,3H2,(H,15,17)(H2,14,16,18) |
| InChI Key | XKQJVBSDCOCZFV-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C=C1NC(=S)NNC(=O)CC#N)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-cyano-, 2-{[(3,4-dichlorophenyl)amino]thioxomethyl}hydrazide |