Systematic / IUPAC Name: 1-[1-(4-Chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-3-(4-fluorophenyl)urea
ID: Reference4375
Other Names:
N-[1-(4-Chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-N'-(4-fluorophenyl)urea ;
Urea, N-[1-(4-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-N'-(4-fluorophenyl)-
Formula: C19H18ClFN4O
N-[1-(4-Chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-N'-(4-fluorophenyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 7:46:21 AM |
| InChI | InChI=1S/C19H18ClFN4O/c1-2-3-18-17(12-22-25(18)16-10-4-13(20)5-11-16)24-19(26)23-15-8-6-14(21)7-9-15/h4-12H,2-3H2,1H3,(H2,23,24,26) |
| InChI Key | MUDXLSHABDQWGE-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=C(C=NN1C2=CC=C(C=C2)Cl)NC(=O)NC3=CC=C(C=C3)F |
| CAS | |
| Splash | |
| Other Names |
N-[1-(4-Chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-N'-(4-fluorophenyl)urea ; Urea, N-[1-(4-chlorophenyl)-5-propyl-1H-pyrazol-4-yl]-N'-(4-fluorophenyl)- |
| ChEMBL | CHEMBL1481105 |
| PubChem | 2808016 |
| ChemSpider | 2086461 |