Systematic / IUPAC Name: 1-[4-(3-Ethyl-2-quinoxalinyl)-1-piperazinyl]-2,2-dimethyl-1-propanone
ID: Reference4380
Other Names: 1-[4-(3-ethylquinoxalin-2-yl)piperazin-1-yl]-2,2-dimethylpropan-1-one
Formula: C19H26N4O
1-[4-(3-ethylquinoxalin-2-yl)piperazino]-2,2-dimethylpropan-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 10:55:55 AM |
| InChI | InChI=1S/C19H26N4O/c1-5-14-17(21-16-9-7-6-8-15(16)20-14)22-10-12-23(13-11-22)18(24)19(2,3)4/h6-9H,5,10-13H2,1-4H3 |
| InChI Key | OQCVYQGOZOFZEQ-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=NC2=CC=CC=C2N=C1N3CCN(CC3)C(=O)C(C)(C)C |
| CAS | |
| Splash | |
| Other Names | 1-[4-(3-ethylquinoxalin-2-yl)piperazin-1-yl]-2,2-dimethylpropan-1-one |