Systematic / IUPAC Name: (2E)-2-(4-Methoxybenzoyl)-3-(2-thienyl)acrylonitrile
ID: Reference4381
Other Names: Benzenepropanenitrile, 4-methoxy-β-oxo-α-(2-thienylmethylene)-, (αE)-
Formula: C15H11NO2S
2-(4-Methoxybenzoyl)-3-(2-thienyl)acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 11:45:55 AM |
| InChI | InChI=1S/C15H11NO2S/c1-18-13-6-4-11(5-7-13)15(17)12(10-16)9-14-3-2-8-19-14/h2-9H,1H3/b12-9+ |
| InChI Key | CPFQNBWNKZOFRT-FMIVXFBMSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)C(=CC2=CC=CS2)C#N |
| CAS | |
| Splash | |
| Other Names | Benzenepropanenitrile, 4-methoxy-β-oxo-α-(2-thienylmethylene)-, (αE)- |