Systematic / IUPAC Name: 1-[(2-Aminophenyl)sulfanyl]-3-{[6-(trifluoromethyl)-2-pyridinyl]oxy}-2-propanol
ID: Reference4382
Other Names: 2-[(2-Hydroxy-3-{[6-(trifluoromethyl)pyridin-2-yl]oxy}propyl)sulfanyl]aniline
Formula: C15H15F3N2O2S
1-[(2-Aminophenyl)thio]-3-{[6-(trifluoromethyl)pyridin-2-yl]oxy}propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 11:23:20 AM |
| InChI | InChI=1S/C15H15F3N2O2S/c16-15(17,18)13-6-3-7-14(20-13)22-8-10(21)9-23-12-5-2-1-4-11(12)19/h1-7,10,21H,8-9,19H2 |
| InChI Key | ZNSCJKGULBHUGS-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)N)SCC(COC2=CC=CC(=N2)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | 2-[(2-Hydroxy-3-{[6-(trifluoromethyl)pyridin-2-yl]oxy}propyl)sulfanyl]aniline |