Systematic / IUPAC Name: N'-(2-Cyano-3-fluorophenyl)-N'-methylethanehydrazonamide
ID: Reference4383
Other Names: Ethanehydrazonamide, N'-(2-cyano-3-fluorophenyl)-N'-methyl-
Formula: C10H11FN4
N'1-(2-Cyano-3-fluorophenyl)-N'1-methylethanimidohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 1:59:26 PM |
| InChI | InChI=1S/C10H11FN4/c1-7(13)14-15(2)10-5-3-4-9(11)8(10)6-12/h3-5H,1-2H3,(H2,13,14) |
| InChI Key | ALUXNCUKCQZUSF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=NN(C)C1=C(C(=CC=C1)F)C#N)N |
| CAS | |
| Splash | |
| Other Names | Ethanehydrazonamide, N'-(2-cyano-3-fluorophenyl)-N'-methyl- |