Systematic / IUPAC Name: 4-{[2-({2-Hydroxy-3-[3-(trifluoromethyl)-1H-pyrazol-1-yl]propyl}sulfanyl)phenyl]amino}-4-oxo-2-butenoic acid
ID: Reference4384
Other Names: 2-Butenoic acid, 4-{[2-({2-hydroxy-3-[3-(trifluoromethyl)-1H-pyrazol-1-yl]propyl}thio)phenyl]amino}-4-oxo-
Formula: C17H16F3N3O4S
4-[2-({2-Hydroxy-3-[3-(trifluoromethyl)-1H-pyrazol-1-yl]propyl}thio)anilino]-4-oxobut-2-enoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2016 1:45:43 PM |
| InChI | InChI=1S/C17H16F3N3O4S/c18-17(19,20)14-7-8-23(22-14)9-11(24)10-28-13-4-2-1-3-12(13)21-15(25)5-6-16(26)27/h1-8,11,24H,9-10H2,(H,21,25)(H,26,27) |
| InChI Key | QIVKDUUHARQRMK-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)NC(=O)C=CC(=O)O)SCC(CN2C=CC(=N2)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | 2-Butenoic acid, 4-{[2-({2-hydroxy-3-[3-(trifluoromethyl)-1H-pyrazol-1-yl]propyl}thio)phenyl]amino}-4-oxo- |