Systematic / IUPAC Name: N-[2,6-Bis(dimethylamino)benzyl]-2,2,2-trichloroacetamide
ID: Reference4389
Other Names: Acetamide, N-{[2,6-bis(dimethylamino)phenyl]methyl}-2,2,2-trichloro-
Formula: C13H18Cl3N3O
N1-[2,6-Bis(dimethylamino)benzyl]-2,2,2-trichloroacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/31/2016 8:57:02 AM |
| InChI | InChI=1S/C13H18Cl3N3O/c1-18(2)10-6-5-7-11(19(3)4)9(10)8-17-12(20)13(14,15)16/h5-7H,8H2,1-4H3,(H,17,20) |
| InChI Key | PVUJTQRWXZLAQQ-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1=C(C(=CC=C1)N(C)C)CNC(=O)C(Cl)(Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Acetamide, N-{[2,6-bis(dimethylamino)phenyl]methyl}-2,2,2-trichloro- |