Systematic / IUPAC Name: 3-{[4-(6-Chloro-1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]carbonyl}-2-pyrazinecarboxylic acid
ID: Reference4400
Other Names: 2-Pyrazinecarboxylic acid, 3-{[4-(6-chloro-2-benzothiazolyl)hexahydro-1H-1,4-diazepin-1-yl]carbonyl}-
Formula: C18H16ClN5O3S
3-{[4-(6-Chloro-1,3-benzothiazol-2-yl)-1,4-diazepan-1-yl]carbonyl}-2-pyrazinecarboxylic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/1/2016 5:51:00 AM |
| InChI | InChI=1S/C18H16ClN5O3S/c19-11-2-3-12-13(10-11)28-18(22-12)24-7-1-6-23(8-9-24)16(25)14-15(17(26)27)21-5-4-20-14/h2-5,10H,1,6-9H2,(H,26,27) |
| InChI Key | MLGIWAABQSWCCF-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN(C1)C(=O)C2=NC=CN=C2C(=O)O)C3=NC4=C(S3)C=C(C=C4)Cl |
| CAS | |
| Splash | |
| Other Names | 2-Pyrazinecarboxylic acid, 3-{[4-(6-chloro-2-benzothiazolyl)hexahydro-1H-1,4-diazepin-1-yl]carbonyl}- |