Systematic / IUPAC Name: [5-Chloro-1'-(5-chloro-2-fluorobenzyl)-2,2',5'-trioxospiro[indole-3,3'-pyrrolidin]-1(2H)-yl]acetic acid
ID: Reference4443
Other Names:
Spiro-indolinone analogue, 71;
Spiro[3H-indole-3,3'-pyrrolidine]-1(2H)-acetic acid, 5-chloro-1'-[(5-chloro-2-fluorophenyl)methyl]-2,2',5'-trioxo-;
5-Chloro-1'-[5-chloro-2-fluorophenyl)methyl]-2,2',5'-trioxo-spiro[3H-indole-3,3'pyrrolidine]-1(2H)-acetic acid
Formula: C20H13Cl2FN2O5
CAY10595 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1686 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/7/2016 9:04:27 AM |
| InChI | InChI=1S/C20H13Cl2FN2O5/c21-11-1-3-14(23)10(5-11)8-25-16(26)7-20(19(25)30)13-6-12(22)2-4-15(13)24(18(20)29)9-17(27)28/h1-6H,7-9H2,(H,27,28) |
| InChI Key | IXKFWNVFUXXEFY-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=O)N(C(=O)C12C3=C(C=CC(=C3)Cl)N(C2=O)CC(=O)O)CC4=C(C=CC(=C4)Cl)F |
| CAS | 916047160 |
| Splash | |
| Other Names |
Spiro-indolinone analogue, 71; Spiro[3H-indole-3,3'-pyrrolidine]-1(2H)-acetic acid, 5-chloro-1'-[(5-chloro-2-fluorophenyl)methyl]-2,2',5'-trioxo-; 5-Chloro-1'-[5-chloro-2-fluorophenyl)methyl]-2,2',5'-trioxo-spiro[3H-indole-3,3'pyrrolidine]-1(2H)-acetic acid |
| ChemSpider | 13091221 |
| PubChem | 15949395 |
| ChEMBL | CHEMBL258965 |