Systematic / IUPAC Name: 1-C-(3,5-Diphenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)pentitol
ID: Reference4450
Other Names: Pentitol, 1-C-(2,3-dihydro-3,5-diphenyl-1,3,4-thiadiazol-2-yl)-
Formula: C19H22N2O5S
1-(3,5-Diphenyl-2,3-dihydro-1,3,4-thiadiazol-2-yl)pentane-1,2,3,4,5-pentaol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 287 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/7/2016 11:37:11 AM |
| InChI | InChI=1S/C19H22N2O5S/c22-11-14(23)15(24)16(25)17(26)19-21(13-9-5-2-6-10-13)20-18(27-19)12-7-3-1-4-8-12/h1-10,14-17,19,22-26H,11H2 |
| InChI Key | VUQJKMSFHNJYKZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C2=NN(C(S2)C(C(C(C(CO)O)O)O)O)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Pentitol, 1-C-(2,3-dihydro-3,5-diphenyl-1,3,4-thiadiazol-2-yl)- |