Systematic / IUPAC Name: N-(4-Cyano-1-phenyl-1H-pyrazol-5-yl)-2-(4-methyl-1-piperazinyl)acetamide
ID: Reference4451
Other Names: 1-Piperazineacetamide, N-(4-cyano-1-phenyl-1H-pyrazol-5-yl)-4-methyl-
Formula: C17H20N6O
N-(4-cyano-1-phenyl-1H-pyrazol-5-yl)-2-(4-methylpiperazino)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/7/2016 12:35:02 PM |
| InChI | InChI=1S/C17H20N6O/c1-21-7-9-22(10-8-21)13-16(24)20-17-14(11-18)12-19-23(17)15-5-3-2-4-6-15/h2-6,12H,7-10,13H2,1H3,(H,20,24) |
| InChI Key | PQUKIXAKDBOLFX-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN(CC1)CC(=O)NC2=C(C=NN2C3=CC=CC=C3)C#N |
| CAS | |
| Splash | |
| Other Names | 1-Piperazineacetamide, N-(4-cyano-1-phenyl-1H-pyrazol-5-yl)-4-methyl- |
| ChEMBL | CHEMBL1471720 |
| ChemSpider | 2094916 |
| PubChem | 2816577 |