Systematic / IUPAC Name: N-[2-Hydroxy-3-(4-methoxyphenoxy)propyl]cyclobutanecarboxamide
ID: Reference4467
Other Names: Cyclobutanecarboxamide, N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-
Formula: C15H21NO4
N-[2-Hydroxy-3-(4-methoxyphenoxy)propyl]cyclobutanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 191 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2016 7:42:35 AM |
| InChI | InChI=1S/C15H21NO4/c1-19-13-5-7-14(8-6-13)20-10-12(17)9-16-15(18)11-3-2-4-11/h5-8,11-12,17H,2-4,9-10H2,1H3,(H,16,18) |
| InChI Key | DPWYKFPMXBRLNX-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)OCC(CNC(=O)C2CCC2)O |
| CAS | |
| Splash | |
| Other Names | Cyclobutanecarboxamide, N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]- |