Systematic / IUPAC Name: 1-[4-(Benzyloxy)phenyl]-3-(4-cyanobenzyl)urea
ID: Reference4469
Other Names:
N-[4-(Benzyloxy)phenyl]-N'-(4-cyanobenzyl)urea ;
Urea, N-[(4-cyanophenyl)methyl]-N'-[4-(phenylmethoxy)phenyl]-
Formula: C22H19N3O2
N-[4-(Benzyloxy)phenyl]-N'-(4-cyanobenzyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2016 9:54:21 AM |
| InChI | InChI=1S/C22H19N3O2/c23-14-17-6-8-18(9-7-17)15-24-22(26)25-20-10-12-21(13-11-20)27-16-19-4-2-1-3-5-19/h1-13H,15-16H2,(H2,24,25,26) |
| InChI Key | IERFTTOEXQZMLJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)NC(=O)NCC3=CC=C(C=C3)C#N |
| CAS | |
| Splash | |
| Other Names |
N-[4-(Benzyloxy)phenyl]-N'-(4-cyanobenzyl)urea ; Urea, N-[(4-cyanophenyl)methyl]-N'-[4-(phenylmethoxy)phenyl]- |