Systematic / IUPAC Name: 2-Furyl(5-hydroxy-1-benzofuran-3-yl)methanone
ID: Reference4471
Other Names:
2-Furyl 5-hydroxybenzo[b]furan-3-yl ketone;
Furan-2-yl(5-hydroxy-1-benzofuran-3-yl)methanone;
Methanone, (5-hydroxy-3-benzofuryl)(2-furyl)-
Formula: C13H8O4
2-Furyl(5-hydroxy-1-benzofuran-3-yl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2016 9:04:00 AM |
| InChI | InChI=1S/C13H8O4/c14-8-3-4-11-9(6-8)10(7-17-11)13(15)12-2-1-5-16-12/h1-7,14H |
| InChI Key | BAJVTNDELBXKDE-UHFFFAOYSA-N |
| Canonical SMILES | C1=COC(=C1)C(=O)C2=COC3=C2C=C(C=C3)O |
| CAS | |
| Splash | |
| Other Names |
2-Furyl 5-hydroxybenzo[b]furan-3-yl ketone; Furan-2-yl(5-hydroxy-1-benzofuran-3-yl)methanone; Methanone, (5-hydroxy-3-benzofuryl)(2-furyl)- |