Systematic / IUPAC Name: 2-Methoxy-N-{(E)-2-[1-(2-naphthyl)-1H-tetrazol-5-yl]vinyl}-5-(trifluoromethyl)aniline
ID: Reference4472
Other Names: Benzenamine, 2-methoxy-N-{(E)-2-[1-(2-naphthalenyl)-1H-tetrazol-5-yl]ethenyl}-5-(trifluoromethyl)-
Formula: C21H16F3N5O
2-Methoxy-N-{2-[1-(2-naphthyl)-1H-1,2,3,4-tetraazol-5-yl]vinyl}-5-(trifluoromethyl)aniline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 260 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/8/2016 10:00:46 AM |
| InChI | InChI=1S/C21H16F3N5O/c1-30-19-9-7-16(21(22,23)24)13-18(19)25-11-10-20-26-27-28-29(20)17-8-6-14-4-2-3-5-15(14)12-17/h2-13,25H,1H3/b11-10+ |
| InChI Key | FMIGUFAJGVNVRR-ZHACJKMWSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)C(F)(F)F)NC=CC2=NN=NN2C3=CC4=CC=CC=C4C=C3 |
| CAS | |
| Splash | |
| Other Names | Benzenamine, 2-methoxy-N-{(E)-2-[1-(2-naphthalenyl)-1H-tetrazol-5-yl]ethenyl}-5-(trifluoromethyl)- |
| ChEMBL | CHEMBL1579896 |
| ChemSpider | 4652184 |
| PubChem | 5714812 |