Systematic / IUPAC Name: 2-{[2-(1-Pyrrolidinyl)-5-(trifluoromethyl)phenyl]carbamoyl}benzoic acid
ID: Reference4483
Other Names: Benzoic acid, 2-({[2-(1-pyrrolidinyl)-5-(trifluoromethyl)phenyl]amino}carbonyl)-
Formula: C19H17F3N2O3
2-{[2-(1-Pyrrolidinyl)-5-(trifluoromethyl)anilino]carbonyl}benzoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:06:25 AM |
| InChI | InChI=1S/C19H17F3N2O3/c20-19(21,22)12-7-8-16(24-9-3-4-10-24)15(11-12)23-17(25)13-5-1-2-6-14(13)18(26)27/h1-2,5-8,11H,3-4,9-10H2,(H,23,25)(H,26,27) |
| InChI Key | AZTAALUEPVXZTQ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCN(C1)C2=C(C=C(C=C2)C(F)(F)F)NC(=O)C3=CC=CC=C3C(=O)O |
| CAS | |
| Splash | |
| Other Names | Benzoic acid, 2-({[2-(1-pyrrolidinyl)-5-(trifluoromethyl)phenyl]amino}carbonyl)- |
| ChEMBL | CHEMBL1540214 |
| ChemSpider | 2093192 |
| PubChem | 2814807 |