Systematic / IUPAC Name: {2-[(2-Cyano-3-fluorophenyl)amino]-2-oxoethoxy}acetic acid
ID: Reference4485
Other Names: Acetic acid, 2-{2-[(2-cyano-3-fluorophenyl)amino]-2-oxoethoxy}-
Formula: C11H9FN2O4
2-[2-(2-Cyano-3-fluoroanilino)-2-oxoethoxy]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:11:47 AM |
| InChI | InChI=1S/C11H9FN2O4/c12-8-2-1-3-9(7(8)4-13)14-10(15)5-18-6-11(16)17/h1-3H,5-6H2,(H,14,15)(H,16,17) |
| InChI Key | NVOBWMGWRSZQSN-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C#N)NC(=O)COCC(=O)O |
| CAS | |
| Splash | |
| Other Names | Acetic acid, 2-{2-[(2-cyano-3-fluorophenyl)amino]-2-oxoethoxy}- |