Systematic / IUPAC Name: N-Cyclohexyl-N-methyl-5-(2-pyridinyl)-2-thiophenesulfonamide
ID: Reference4487
Other Names:
N-Cyclohexyl-N-methyl-5-(pyridin-2-yl)thiophene-2-sulfonamide;
2-Thiophenesulfonamide, N-cyclohexyl-N-methyl-5-(2-pyridinyl)-
Formula: C16H20N2O2S2
N-Cyclohexyl-N-methyl-5-(2-pyridinyl)-2-thiophenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 117 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:15:13 AM |
| InChI | InChI=1S/C16H20N2O2S2/c1-18(13-7-3-2-4-8-13)22(19,20)16-11-10-15(21-16)14-9-5-6-12-17-14/h5-6,9-13H,2-4,7-8H2,1H3 |
| InChI Key | ZOXPTDZGTVHLDO-UHFFFAOYSA-N |
| Canonical SMILES | CN(C1CCCCC1)S(=O)(=O)C2=CC=C(S2)C3=CC=CC=N3 |
| CAS | |
| Splash | |
| Other Names |
N-Cyclohexyl-N-methyl-5-(pyridin-2-yl)thiophene-2-sulfonamide; 2-Thiophenesulfonamide, N-cyclohexyl-N-methyl-5-(2-pyridinyl)- |
| PubChem | 2813897 |
| ChEMBL | CHEMBL1461451 |
| ChemSpider | 2092293 |