Systematic / IUPAC Name: 2-(4-Chlorophenyl)-2-oxoethyl dimethylcarbamodithioate
ID: Reference4488
Other Names:
2-[(Dimethylamino)thioxomethylthio]-1-(4-chlorophenyl)ethan-1-one;
Carbamodithioic acid, dimethyl, 2-(4-chlorophenyl)-2-oxoethyl ester
Formula: C11H12ClNOS2
2-(4-Chlorophenyl)-2-oxoethyl N,N-dimethylcarbamodithioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 210 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:17:34 AM |
| InChI | InChI=1S/C11H12ClNOS2/c1-13(2)11(15)16-7-10(14)8-3-5-9(12)6-4-8/h3-6H,7H2,1-2H3 |
| InChI Key | MERMCWRIKDJYCI-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=S)SCC(=O)C1=CC=C(C=C1)Cl |
| CAS | |
| Splash | |
| Other Names |
2-[(Dimethylamino)thioxomethylthio]-1-(4-chlorophenyl)ethan-1-one; Carbamodithioic acid, dimethyl, 2-(4-chlorophenyl)-2-oxoethyl ester |