Systematic / IUPAC Name: Ethyl 6-methyl-2-{[(4-methylphenyl)carbamoyl]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
ID: Reference4489
Other Names: Benzo[b]thiophene-3-carboxylic acid, 4,5,6,7-tetrahydro-6-methyl-2-({[(4-methylphenyl)amino]carbonyl}amino)-, ethyl ester
Formula: C20H24N2O3S
Ethyl 6-methyl-2-[(4-toluidinocarbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 234 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 4/11/2016 7:19:16 AM |
| InChI | InChI=1S/C20H24N2O3S/c1-4-25-19(23)17-15-10-7-13(3)11-16(15)26-18(17)22-20(24)21-14-8-5-12(2)6-9-14/h5-6,8-9,13H,4,7,10-11H2,1-3H3,(H2,21,22,24) |
| InChI Key | VHQBOMFTTURNQM-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)C1=C(SC2=C1CCC(C2)C)NC(=O)NC3=CC=C(C=C3)C |
| CAS | |
| Splash | |
| Other Names | Benzo[b]thiophene-3-carboxylic acid, 4,5,6,7-tetrahydro-6-methyl-2-({[(4-methylphenyl)amino]carbonyl}amino)-, ethyl ester |